C9H16N2O4S — CID 66241373
4-(2-methylsulfanylethylcarbamoylamino)oxolane-3-carboxylic acid (PubChem CID 66241373) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-(2-methylsulfanylethylcarbamoylamino)oxolane-3-carboxylic acid.
| Compound Name | 4-(2-methylsulfanylethylcarbamoylamino)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66241373 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(2-methylsulfanylethylcarbamoylamino)oxolane-3-carboxylic acid |
| SMILES | CSCCNC(=O)NC1COCC1C(=O)O |
| InChI | InChI=1S/C9H16N2O4S/c1-16-3-2-10-9(14)11-7-5-15-4-6(7)8(12)13/h6-7H,2-5H2,1H3,(H,12,13)(H2,10,11,14) |
| InChIKey | RGBGVSRZLVMOGY-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|