C11H17N3O5 — CID 66239754
4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]oxolane-3-carboxylic acid (PubChem CID 66239754) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66239754 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]oxolane-3-carboxylic acid |
| SMILES | O=C(CNC(=O)NC1COCC1C(=O)O)NC1CC1 |
| InChI | InChI=1S/C11H17N3O5/c15-9(13-6-1-2-6)3-12-11(18)14-8-5-19-4-7(8)10(16)17/h6-8H,1-5H2,(H,13,15)(H,16,17)(H2,12,14,18) |
| InChIKey | PZVFWDIPRGXZSU-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |