C8H13N3O5 — CID 66241326
4-[(2-amino-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid (PubChem CID 66241326) has the molecular formula C8H13N3O5 and a molecular weight of 231.21 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2-amino-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66241326 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4-[(2-amino-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid |
| SMILES | NC(=O)CNC(=O)NC1COCC1C(=O)O |
| InChI | InChI=1S/C8H13N3O5/c9-6(12)1-10-8(15)11-5-3-16-2-4(5)7(13)14/h4-5H,1-3H2,(H2,9,12)(H,13,14)(H2,10,11,15) |
| InChIKey | PBDZHINLEIKFTI-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |