C15H18N4O2 — CID 662455
6-amino-1-phenyl-5-piperidin-1-ylpyrimidine-2,4-dione (PubChem CID 662455) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 6-amino-1-phenyl-5-piperidin-1-ylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-phenyl-5-piperidin-1-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 662455 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 6-amino-1-phenyl-5-piperidin-1-ylpyrimidine-2,4-dione |
| SMILES | Nc1c(N2CCCCC2)c(=O)[nH]c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C15H18N4O2/c16-13-12(18-9-5-2-6-10-18)14(20)17-15(21)19(13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,16H2,(H,17,20,21) |
| InChIKey | WEOANPSUSNCHBY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |