C13H20N2O5 — CID 66247666
4-[ethyl-(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]oxolane-3-carboxylic acid (PubChem CID 66247666) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-[ethyl-(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[ethyl-(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66247666 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-[ethyl-(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]oxolane-3-carboxylic acid |
| SMILES | CCN1C(=O)CC(N(CC)C2COCC2C(=O)O)C1=O |
| InChI | InChI=1S/C13H20N2O5/c1-3-14(10-7-20-6-8(10)13(18)19)9-5-11(16)15(4-2)12(9)17/h8-10H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | DMRVJERQNJHXGI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|