C13H23NO3 — CID 103565205
4-[(3-methylcyclobutyl)-propylamino]oxolane-3-carboxylic acid (PubChem CID 103565205) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-[(3-methylcyclobutyl)-propylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3-methylcyclobutyl)-propylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 103565205 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 4-[(3-methylcyclobutyl)-propylamino]oxolane-3-carboxylic acid |
| SMILES | CCCN(C1CC(C)C1)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H23NO3/c1-3-4-14(10-5-9(2)6-10)12-8-17-7-11(12)13(15)16/h9-12H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | NACMBNQLNCDYSV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |