C13H23NO5S — CID 66251366
4-[(1,1-dioxothian-4-yl)-propylamino]oxolane-3-carboxylic acid (PubChem CID 66251366) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)-propylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(1,1-dioxothian-4-yl)-propylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66251366 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)-propylamino]oxolane-3-carboxylic acid |
| SMILES | CCCN(C1CCS(=O)(=O)CC1)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H23NO5S/c1-2-5-14(10-3-6-20(17,18)7-4-10)12-9-19-8-11(12)13(15)16/h10-12H,2-9H2,1H3,(H,15,16) |
| InChIKey | VNOJRODHHBLHFB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |