C12H21NO3S — CID 66253306
4-[propyl(thiolan-3-yl)amino]oxolane-3-carboxylic acid (PubChem CID 66253306) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 4-[propyl(thiolan-3-yl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[propyl(thiolan-3-yl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66253306 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-[propyl(thiolan-3-yl)amino]oxolane-3-carboxylic acid |
| SMILES | CCCN(C1CCSC1)C1COCC1C(=O)O |
| InChI | InChI=1S/C12H21NO3S/c1-2-4-13(9-3-5-17-8-9)11-7-16-6-10(11)12(14)15/h9-11H,2-8H2,1H3,(H,14,15) |
| InChIKey | VWGYEUBDTOOQKY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |