C22H30N4O2S — CID 6624875
N-[3-(azepan-1-yl)propyl]-2-(dimethylamino)-8-methylfuro[2,3-g][1,3]benzothiazole-7-carboxamide (PubChem CID 6624875) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-2-(dimethylamino)-8-methylfuro[2,3-g][1,3]benzothiazole-7-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-2-(dimethylamino)-8-methylfuro[2,3-g][1,3]benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 6624875 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-2-(dimethylamino)-8-methylfuro[2,3-g][1,3]benzothiazole-7-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN2CCCCCC2)oc2ccc3nc(N(C)C)sc3c12 |
| InChI | InChI=1S/C22H30N4O2S/c1-15-18-17(10-9-16-20(18)29-22(24-16)25(2)3)28-19(15)21(27)23-11-8-14-26-12-6-4-5-7-13-26/h9-10H,4-8,11-14H2,1-3H3,(H,23,27) |
| InChIKey | OXCMXTNGRMTDOE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|