C13H18N2O5 — CID 66250151
4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-3-methyloxolane-3-carboxylic acid (PubChem CID 66250151) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-3-methyloxolane-3-carboxylic acid.
| Compound Name | 4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-3-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66250151 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-[[furan-2-ylmethyl(methyl)carbamoyl]amino]-3-methyloxolane-3-carboxylic acid |
| SMILES | CN(Cc1ccco1)C(=O)NC1COCC1(C)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c1-13(11(16)17)8-19-7-10(13)14-12(18)15(2)6-9-4-3-5-20-9/h3-5,10H,6-8H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | ZGPAYZJPZFSMCL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |