C13H18N2O4S — CID 66250152
3-methyl-4-[[methyl(thiophen-2-ylmethyl)carbamoyl]amino]oxolane-3-carboxylic acid (PubChem CID 66250152) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-methyl-4-[[methyl(thiophen-2-ylmethyl)carbamoyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 3-methyl-4-[[methyl(thiophen-2-ylmethyl)carbamoyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66250152 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-methyl-4-[[methyl(thiophen-2-ylmethyl)carbamoyl]amino]oxolane-3-carboxylic acid |
| SMILES | CN(Cc1cccs1)C(=O)NC1COCC1(C)C(=O)O |
| InChI | InChI=1S/C13H18N2O4S/c1-13(11(16)17)8-19-7-10(13)14-12(18)15(2)6-9-4-3-5-20-9/h3-5,10H,6-8H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | LCFQKONYEIAAHF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |