C14H22N2O3S — CID 66249657
4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiophen-2-ylmethyl)oxolane-3-carboxamide (PubChem CID 66249657) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiophen-2-ylmethyl)oxolane-3-carboxamide.
| Compound Name | 4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiophen-2-ylmethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66249657 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiophen-2-ylmethyl)oxolane-3-carboxamide |
| SMILES | COCCN(Cc1cccs1)C(=O)C1(C)COCC1N |
| InChI | InChI=1S/C14H22N2O3S/c1-14(10-19-9-12(14)15)13(17)16(5-6-18-2)8-11-4-3-7-20-11/h3-4,7,12H,5-6,8-10,15H2,1-2H3 |
| InChIKey | LTSWCPWSIHKBIK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |