C11H12ClNO4S — CID 80644457
4-[(3-chlorothiophene-2-carbonyl)amino]-3-methyloxolane-3-carboxylic acid (PubChem CID 80644457) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is 4-[(3-chlorothiophene-2-carbonyl)amino]-3-methyloxolane-3-carboxylic acid.
| Compound Name | 4-[(3-chlorothiophene-2-carbonyl)amino]-3-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 80644457 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-[(3-chlorothiophene-2-carbonyl)amino]-3-methyloxolane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)COCC1NC(=O)c1sccc1Cl |
| InChI | InChI=1S/C11H12ClNO4S/c1-11(10(15)16)5-17-4-7(11)13-9(14)8-6(12)2-3-18-8/h2-3,7H,4-5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | PHWQDFLDTPCTJQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |