C11H21NO6S — CID 66252056
4-[2-methoxyethylsulfonyl(propyl)amino]oxolane-3-carboxylic acid (PubChem CID 66252056) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is 4-[2-methoxyethylsulfonyl(propyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[2-methoxyethylsulfonyl(propyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66252056 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[2-methoxyethylsulfonyl(propyl)amino]oxolane-3-carboxylic acid |
| SMILES | CCCN(C1COCC1C(=O)O)S(=O)(=O)CCOC |
| InChI | InChI=1S/C11H21NO6S/c1-3-4-12(19(15,16)6-5-17-2)10-8-18-7-9(10)11(13)14/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | YXLVFLWIUQUAEA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |