C12H19ClN2OS — CID 66259724
4-[[(5-chlorothiophen-2-yl)methylamino]methyl]-N-ethyloxolan-3-amine (PubChem CID 66259724) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 4-[[(5-chlorothiophen-2-yl)methylamino]methyl]-N-ethyloxolan-3-amine.
| Compound Name | 4-[[(5-chlorothiophen-2-yl)methylamino]methyl]-N-ethyloxolan-3-amine |
|---|---|
| PubChem CID | 66259724 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-[[(5-chlorothiophen-2-yl)methylamino]methyl]-N-ethyloxolan-3-amine |
| SMILES | CCNC1COCC1CNCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-2-15-11-8-16-7-9(11)5-14-6-10-3-4-12(13)17-10/h3-4,9,11,14-15H,2,5-8H2,1H3 |
| InChIKey | CSMRPMCVDIEOEU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |