C13H18ClNO2S — CID 79532810
4-[[(5-chlorothiophen-2-yl)methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 79532810) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is 4-[[(5-chlorothiophen-2-yl)methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(5-chlorothiophen-2-yl)methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79532810 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-[[(5-chlorothiophen-2-yl)methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNCc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H18ClNO2S/c14-12-6-5-11(18-12)8-15-7-9-1-3-10(4-2-9)13(16)17/h5-6,9-10,15H,1-4,7-8H2,(H,16,17) |
| InChIKey | VGWNJVVXBCCKRF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |