C11H14N2O2S — CID 66261905
1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-pyridin-4-ylsulfanylethanone (PubChem CID 66261905) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-pyridin-4-ylsulfanylethanone.
| Compound Name | 1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-pyridin-4-ylsulfanylethanone |
|---|---|
| PubChem CID | 66261905 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-pyridin-4-ylsulfanylethanone |
| SMILES | O=C(CSc1ccncc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H14N2O2S/c14-9-3-6-13(7-9)11(15)8-16-10-1-4-12-5-2-10/h1-2,4-5,9,14H,3,6-8H2/t9-/m1/s1 |
| InChIKey | CSRXODMZDRNLAL-SECBINFHSA-N |
| XLogP | 0.77 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |