C12H22N2O — CID 66262644
4-[[bis(prop-2-enyl)amino]methyl]-4-methyloxolan-3-amine (PubChem CID 66262644) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-[[bis(prop-2-enyl)amino]methyl]-4-methyloxolan-3-amine.
| Compound Name | 4-[[bis(prop-2-enyl)amino]methyl]-4-methyloxolan-3-amine |
|---|---|
| PubChem CID | 66262644 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-[[bis(prop-2-enyl)amino]methyl]-4-methyloxolan-3-amine |
| SMILES | C=CCN(CC=C)CC1(C)COCC1N |
| InChI | InChI=1S/C12H22N2O/c1-4-6-14(7-5-2)9-12(3)10-15-8-11(12)13/h4-5,11H,1-2,6-10,13H2,3H3 |
| InChIKey | BZLRDVZWFYNSBF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|