C11H18N2O4 — CID 66267016
1-[4-(methylamino)oxolane-3-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 66267016) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[4-(methylamino)oxolane-3-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-(methylamino)oxolane-3-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66267016 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-[4-(methylamino)oxolane-3-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CNC1COCC1C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C11H18N2O4/c1-12-8-6-17-5-7(8)10(14)13-4-2-3-9(13)11(15)16/h7-9,12H,2-6H2,1H3,(H,15,16) |
| InChIKey | CTPGHKJHDVCCBG-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |