C14H25N3O4 — CID 83098461
4-[4-(methylamino)oxolane-3-carbonyl]-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 83098461) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[4-(methylamino)oxolane-3-carbonyl]-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-[4-(methylamino)oxolane-3-carbonyl]-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098461 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 4-[4-(methylamino)oxolane-3-carbonyl]-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CNC1COCC1C(=O)N1CCOCC1C(=O)NC(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-9(2)16-13(18)12-8-20-5-4-17(12)14(19)10-6-21-7-11(10)15-3/h9-12,15H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | YUAAGUJATXZSKM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |