C14H23N3O3 — CID 83097662
4-(4-aminocyclopent-2-ene-1-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 83097662) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(4-aminocyclopent-2-ene-1-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-(4-aminocyclopent-2-ene-1-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83097662 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-(4-aminocyclopent-2-ene-1-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1COCCN1C(=O)C1C=CC(N)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)16-13(18)12-8-20-6-5-17(12)14(19)10-3-4-11(15)7-10/h3-4,9-12H,5-8,15H2,1-2H3,(H,16,18) |
| InChIKey | WXGQCMQXYXILRI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|