C11H22N6O2 — CID 66268955
2-[2-(dimethylamino)ethylamino]-2-[1-(3-hydroxypropyl)triazol-4-yl]acetamide (PubChem CID 66268955) has the molecular formula C11H22N6O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-2-[1-(3-hydroxypropyl)triazol-4-yl]acetamide.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-2-[1-(3-hydroxypropyl)triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 66268955 |
| Molecular Formula | C11H22N6O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-2-[1-(3-hydroxypropyl)triazol-4-yl]acetamide |
| SMILES | CN(C)CCNC(C(N)=O)c1cn(CCCO)nn1 |
| InChI | InChI=1S/C11H22N6O2/c1-16(2)6-4-13-10(11(12)19)9-8-17(15-14-9)5-3-7-18/h8,10,13,18H,3-7H2,1-2H3,(H2,12,19) |
| InChIKey | YROXGROHIVIJOT-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |