C12H17N5O3S — CID 66269114
3-[4-[[(6-methylsulfonyl-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 66269114) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 3-[4-[[(6-methylsulfonyl-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[(6-methylsulfonyl-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66269114 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[4-[[(6-methylsulfonyl-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(NCc2cn(CCCO)nn2)cn1 |
| InChI | InChI=1S/C12H17N5O3S/c1-21(19,20)12-4-3-10(7-14-12)13-8-11-9-17(16-15-11)5-2-6-18/h3-4,7,9,13,18H,2,5-6,8H2,1H3 |
| InChIKey | SPHMOMUKNNKKGN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |