C13H22N2O2S — CID 66269555
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4,4-dimethoxybutan-1-amine (PubChem CID 66269555) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4,4-dimethoxybutan-1-amine.
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4,4-dimethoxybutan-1-amine |
|---|---|
| PubChem CID | 66269555 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4,4-dimethoxybutan-1-amine |
| SMILES | COC(CC(CN)N1CCc2sccc2C1)OC |
| InChI | InChI=1S/C13H22N2O2S/c1-16-13(17-2)7-11(8-14)15-5-3-12-10(9-15)4-6-18-12/h4,6,11,13H,3,5,7-9,14H2,1-2H3 |
| InChIKey | WVGFCYHFWAMIOT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|