C15H24N2O3 — CID 66270707
2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4,4-dimethoxybutan-1-amine (PubChem CID 66270707) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4,4-dimethoxybutan-1-amine.
| Compound Name | 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4,4-dimethoxybutan-1-amine |
|---|---|
| PubChem CID | 66270707 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4,4-dimethoxybutan-1-amine |
| SMILES | COC(CC(CN)N1CCOc2ccccc2C1)OC |
| InChI | InChI=1S/C15H24N2O3/c1-18-15(19-2)9-13(10-16)17-7-8-20-14-6-4-3-5-12(14)11-17/h3-6,13,15H,7-11,16H2,1-2H3 |
| InChIKey | SHWVONCORXATCS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|