C14H18N2O — CID 55159835
3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentanenitrile (PubChem CID 55159835) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentanenitrile.
| Compound Name | 3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentanenitrile |
|---|---|
| PubChem CID | 55159835 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentanenitrile |
| SMILES | CCC(CC#N)N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C14H18N2O/c1-2-13(7-8-15)16-9-10-17-14-6-4-3-5-12(14)11-16/h3-6,13H,2,7,9-11H2,1H3 |
| InChIKey | OEGHAKMNQAJEOY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |