C13H19N5O2 — CID 66269873
3-[4-[[(2-ethoxy-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 66269873) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-[4-[[(2-ethoxy-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[(2-ethoxy-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66269873 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-[4-[[(2-ethoxy-3-pyridinyl)amino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | CCOc1ncccc1NCc1cn(CCCO)nn1 |
| InChI | InChI=1S/C13H19N5O2/c1-2-20-13-12(5-3-6-14-13)15-9-11-10-18(17-16-11)7-4-8-19/h3,5-6,10,15,19H,2,4,7-9H2,1H3 |
| InChIKey | MBYNQHNNVIRYLT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |