C12H13ClN4O3 — CID 66270034
2-(3-chloroanilino)-2-[1-(2-hydroxyethyl)triazol-4-yl]acetic acid (PubChem CID 66270034) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 2-(3-chloroanilino)-2-[1-(2-hydroxyethyl)triazol-4-yl]acetic acid.
| Compound Name | 2-(3-chloroanilino)-2-[1-(2-hydroxyethyl)triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 66270034 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(3-chloroanilino)-2-[1-(2-hydroxyethyl)triazol-4-yl]acetic acid |
| SMILES | O=C(O)C(Nc1cccc(Cl)c1)c1cn(CCO)nn1 |
| InChI | InChI=1S/C12H13ClN4O3/c13-8-2-1-3-9(6-8)14-11(12(19)20)10-7-17(4-5-18)16-15-10/h1-3,6-7,11,14,18H,4-5H2,(H,19,20) |
| InChIKey | PHVFVJXYCYEXSD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |