C11H17N5O2 — CID 66271541
2-[2-hydroxy-3-(propylamino)propyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66271541) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(propylamino)propyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[2-hydroxy-3-(propylamino)propyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66271541 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-[2-hydroxy-3-(propylamino)propyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CCCNCC(O)Cn1nc2cnccn2c1=O |
| InChI | InChI=1S/C11H17N5O2/c1-2-3-12-6-9(17)8-16-11(18)15-5-4-13-7-10(15)14-16/h4-5,7,9,12,17H,2-3,6,8H2,1H3 |
| InChIKey | ILUZMRKJBGNOMX-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|