C11H18N2S — CID 66272071
N-ethyl-1-(4-methyl-3-pyridinyl)-2-methylsulfanylethanamine (PubChem CID 66272071) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-ethyl-1-(4-methyl-3-pyridinyl)-2-methylsulfanylethanamine.
| Compound Name | N-ethyl-1-(4-methyl-3-pyridinyl)-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 66272071 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-ethyl-1-(4-methyl-3-pyridinyl)-2-methylsulfanylethanamine |
| SMILES | CCNC(CSC)c1cnccc1C |
| InChI | InChI=1S/C11H18N2S/c1-4-13-11(8-14-3)10-7-12-6-5-9(10)2/h5-7,11,13H,4,8H2,1-3H3 |
| InChIKey | UEIBTFUKOOZTII-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |