C19H18N2O3S2 — CID 662742
4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine (PubChem CID 662742) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 662742 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1cccc(-c2csc(-c3ccccc3)n2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H18N2O3S2/c22-26(23,21-9-11-24-12-10-21)17-8-4-7-16(13-17)18-14-25-19(20-18)15-5-2-1-3-6-15/h1-8,13-14H,9-12H2 |
| InChIKey | RHZXDVOZXKXIEV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |