C16H14N2O5S3 — CID 57340181
[2-[4-(benzenesulfonyl)phenyl]-1,3-thiazol-4-yl]methyl sulfamate (PubChem CID 57340181) has the molecular formula C16H14N2O5S3 and a molecular weight of 410.50 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)phenyl]-1,3-thiazol-4-yl]methyl sulfamate.
| Compound Name | [2-[4-(benzenesulfonyl)phenyl]-1,3-thiazol-4-yl]methyl sulfamate |
|---|---|
| PubChem CID | 57340181 |
| Molecular Formula | C16H14N2O5S3 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | [2-[4-(benzenesulfonyl)phenyl]-1,3-thiazol-4-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCc1csc(-c2ccc(S(=O)(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C16H14N2O5S3/c17-26(21,22)23-10-13-11-24-16(18-13)12-6-8-15(9-7-12)25(19,20)14-4-2-1-3-5-14/h1-9,11H,10H2,(H2,17,21,22) |
| InChIKey | QMENHRQBUNHPJP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |