C11H14F3NO2 — CID 66274762
1-(2-aminophenyl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanol (PubChem CID 66274762) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanol.
| Compound Name | 1-(2-aminophenyl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanol |
|---|---|
| PubChem CID | 66274762 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(2-aminophenyl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanol |
| SMILES | CC(OCC(O)c1ccccc1N)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2/c1-7(11(12,13)14)17-6-10(16)8-4-2-3-5-9(8)15/h2-5,7,10,16H,6,15H2,1H3 |
| InChIKey | HFNLNSYPUNJNSR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|