C14H15F3N2O2 — CID 66275671
N-(4-cyanophenyl)-4-(1,1,1-trifluoropropan-2-yloxy)butanamide (PubChem CID 66275671) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-(1,1,1-trifluoropropan-2-yloxy)butanamide.
| Compound Name | N-(4-cyanophenyl)-4-(1,1,1-trifluoropropan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 66275671 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(4-cyanophenyl)-4-(1,1,1-trifluoropropan-2-yloxy)butanamide |
| SMILES | CC(OCCCC(=O)Nc1ccc(C#N)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O2/c1-10(14(15,16)17)21-8-2-3-13(20)19-12-6-4-11(9-18)5-7-12/h4-7,10H,2-3,8H2,1H3,(H,19,20) |
| InChIKey | VSFPPQBFXSKNHK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|