C8H9ClF3NOS — CID 66275908
4-(chloromethyl)-2-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazole (PubChem CID 66275908) has the molecular formula C8H9ClF3NOS and a molecular weight of 259.68 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 66275908 |
| Molecular Formula | C8H9ClF3NOS |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-(chloromethyl)-2-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazole |
| SMILES | CC(OCc1nc(CCl)cs1)C(F)(F)F |
| InChI | InChI=1S/C8H9ClF3NOS/c1-5(8(10,11)12)14-3-7-13-6(2-9)4-15-7/h4-5H,2-3H2,1H3 |
| InChIKey | SIDRDFLVHJSJSH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|