C14H26F3NO — CID 66275943
N-[[4-methyl-1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine (PubChem CID 66275943) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[[4-methyl-1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[4-methyl-1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66275943 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N-[[4-methyl-1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(OC(C)C(F)(F)F)CCC(C)CC1 |
| InChI | InChI=1S/C14H26F3NO/c1-4-9-18-10-13(7-5-11(2)6-8-13)19-12(3)14(15,16)17/h11-12,18H,4-10H2,1-3H3 |
| InChIKey | HPCPJMGVDSRBAU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|