C13H21F6NO — CID 102723011
N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine (PubChem CID 102723011) has the molecular formula C13H21F6NO and a molecular weight of 321.31 g/mol. Its IUPAC name is N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102723011 |
| Molecular Formula | C13H21F6NO |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(OC(C(F)(F)F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C13H21F6NO/c1-2-8-20-9-11(6-4-3-5-7-11)21-10(12(14,15)16)13(17,18)19/h10,20H,2-9H2,1H3 |
| InChIKey | QSNVSKSFSDQRBO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|