C12H13F4NO3 — CID 66277853
ethyl 2-amino-4-fluoro-5-(1,1,1-trifluoropropan-2-yloxy)benzoate (PubChem CID 66277853) has the molecular formula C12H13F4NO3 and a molecular weight of 295.23 g/mol. Its IUPAC name is ethyl 2-amino-4-fluoro-5-(1,1,1-trifluoropropan-2-yloxy)benzoate.
| Compound Name | ethyl 2-amino-4-fluoro-5-(1,1,1-trifluoropropan-2-yloxy)benzoate |
|---|---|
| PubChem CID | 66277853 |
| Molecular Formula | C12H13F4NO3 |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | ethyl 2-amino-4-fluoro-5-(1,1,1-trifluoropropan-2-yloxy)benzoate |
| SMILES | CCOC(=O)c1cc(OC(C)C(F)(F)F)c(F)cc1N |
| InChI | InChI=1S/C12H13F4NO3/c1-3-19-11(18)7-4-10(8(13)5-9(7)17)20-6(2)12(14,15)16/h4-6H,3,17H2,1-2H3 |
| InChIKey | HXBQQWFGUPSISZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|