C16H25FN2O2 — CID 63423710
ethyl 2-amino-5-[3,3-dimethylbutan-2-yl(methyl)amino]-4-fluorobenzoate (PubChem CID 63423710) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is ethyl 2-amino-5-[3,3-dimethylbutan-2-yl(methyl)amino]-4-fluorobenzoate.
| Compound Name | ethyl 2-amino-5-[3,3-dimethylbutan-2-yl(methyl)amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 63423710 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | ethyl 2-amino-5-[3,3-dimethylbutan-2-yl(methyl)amino]-4-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(N(C)C(C)C(C)(C)C)c(F)cc1N |
| InChI | InChI=1S/C16H25FN2O2/c1-7-21-15(20)11-8-14(12(17)9-13(11)18)19(6)10(2)16(3,4)5/h8-10H,7,18H2,1-6H3 |
| InChIKey | VMLFESXBAUDSSI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|