C11H15N3O4 — CID 66280015
2-methyl-3-[methyl-(5-methyl-3-nitro-2-pyridinyl)amino]propanoic acid (PubChem CID 66280015) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(5-methyl-3-nitro-2-pyridinyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-(5-methyl-3-nitro-2-pyridinyl)amino]propanoic acid |
|---|---|
| PubChem CID | 66280015 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-methyl-3-[methyl-(5-methyl-3-nitro-2-pyridinyl)amino]propanoic acid |
| SMILES | Cc1cnc(N(C)CC(C)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N3O4/c1-7-4-9(14(17)18)10(12-5-7)13(3)6-8(2)11(15)16/h4-5,8H,6H2,1-3H3,(H,15,16) |
| InChIKey | OHSVVKMMNYXZPE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|