C10H13N3O4 — CID 55007246
2-methyl-3-[methyl-(3-nitro-4-pyridinyl)amino]propanoic acid (PubChem CID 55007246) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(3-nitro-4-pyridinyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-(3-nitro-4-pyridinyl)amino]propanoic acid |
|---|---|
| PubChem CID | 55007246 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-methyl-3-[methyl-(3-nitro-4-pyridinyl)amino]propanoic acid |
| SMILES | CC(CN(C)c1ccncc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H13N3O4/c1-7(10(14)15)6-12(2)8-3-4-11-5-9(8)13(16)17/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | JBUOCBWBJJGVAF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|