C11H12FIN2O4 — CID 66088490
3-(5-fluoro-4-iodo-N-methyl-2-nitroanilino)-2-methylpropanoic acid (PubChem CID 66088490) has the molecular formula C11H12FIN2O4 and a molecular weight of 382.13 g/mol. Its IUPAC name is 3-(5-fluoro-4-iodo-N-methyl-2-nitroanilino)-2-methylpropanoic acid.
| Compound Name | 3-(5-fluoro-4-iodo-N-methyl-2-nitroanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66088490 |
| Molecular Formula | C11H12FIN2O4 |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 3-(5-fluoro-4-iodo-N-methyl-2-nitroanilino)-2-methylpropanoic acid |
| SMILES | CC(CN(C)c1cc(F)c(I)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H12FIN2O4/c1-6(11(16)17)5-14(2)9-3-7(12)8(13)4-10(9)15(18)19/h3-4,6H,5H2,1-2H3,(H,16,17) |
| InChIKey | FRAZHNFKNCGVKV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|