C12H15FN2O5 — CID 107259999
3-(2-fluoro-5-methoxy-N-methyl-4-nitroanilino)-2-methylpropanoic acid (PubChem CID 107259999) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-(2-fluoro-5-methoxy-N-methyl-4-nitroanilino)-2-methylpropanoic acid.
| Compound Name | 3-(2-fluoro-5-methoxy-N-methyl-4-nitroanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 107259999 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-(2-fluoro-5-methoxy-N-methyl-4-nitroanilino)-2-methylpropanoic acid |
| SMILES | COc1cc(N(C)CC(C)C(=O)O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15FN2O5/c1-7(12(16)17)6-14(2)9-5-11(20-3)10(15(18)19)4-8(9)13/h4-5,7H,6H2,1-3H3,(H,16,17) |
| InChIKey | RQNWQJRKAFQBJQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|