C11H11FN2O7 — CID 107260017
2-[N-(carboxymethyl)-2-fluoro-5-methoxy-4-nitroanilino]acetic acid (PubChem CID 107260017) has the molecular formula C11H11FN2O7 and a molecular weight of 302.21 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-2-fluoro-5-methoxy-4-nitroanilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-2-fluoro-5-methoxy-4-nitroanilino]acetic acid |
|---|---|
| PubChem CID | 107260017 |
| Molecular Formula | C11H11FN2O7 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[N-(carboxymethyl)-2-fluoro-5-methoxy-4-nitroanilino]acetic acid |
| SMILES | COc1cc(N(CC(=O)O)CC(=O)O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11FN2O7/c1-21-9-3-7(6(12)2-8(9)14(19)20)13(4-10(15)16)5-11(17)18/h2-3H,4-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | KKZVADYYGMJWQW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|