C12H19N5O — CID 66281415
7-(hexylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66281415) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 7-(hexylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-(hexylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66281415 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 7-(hexylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | CCCCCCNc1cc2n[nH]c(=O)n2c(C)n1 |
| InChI | InChI=1S/C12H19N5O/c1-3-4-5-6-7-13-10-8-11-15-16-12(18)17(11)9(2)14-10/h8,13H,3-7H2,1-2H3,(H,16,18) |
| InChIKey | MAMCCOIVEWTVQQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|