C9H13N5OS — CID 66283954
5-methyl-7-(2-methylsulfanylethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66283954) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 5-methyl-7-(2-methylsulfanylethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-methyl-7-(2-methylsulfanylethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66283954 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 5-methyl-7-(2-methylsulfanylethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | CSCCNc1cc2n[nH]c(=O)n2c(C)n1 |
| InChI | InChI=1S/C9H13N5OS/c1-6-11-7(10-3-4-16-2)5-8-12-13-9(15)14(6)8/h5,10H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | PKGOPLLMTJBPGK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|