C11H9N5O2 — CID 66281474
6-(2-aminophenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66281474) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 6-(2-aminophenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(2-aminophenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66281474 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 6-(2-aminophenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | Nc1ccccc1Oc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C11H9N5O2/c12-7-3-1-2-4-8(7)18-10-6-5-9-13-14-11(17)16(9)15-10/h1-6H,12H2,(H,14,17) |
| InChIKey | ZGRGRBGYCPNUMB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|