C11H8BrFN2O2S — CID 66284562
5-bromo-2-[(2-fluorophenyl)sulfanylmethyl]-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 66284562) has the molecular formula C11H8BrFN2O2S and a molecular weight of 331.17 g/mol. Its IUPAC name is 5-bromo-2-[(2-fluorophenyl)sulfanylmethyl]-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-[(2-fluorophenyl)sulfanylmethyl]-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66284562 |
| Molecular Formula | C11H8BrFN2O2S |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 5-bromo-2-[(2-fluorophenyl)sulfanylmethyl]-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CSc2ccccc2F)nc(O)c1Br |
| InChI | InChI=1S/C11H8BrFN2O2S/c12-9-10(16)14-8(15-11(9)17)5-18-7-4-2-1-3-6(7)13/h1-4H,5H2,(H2,14,15,16,17) |
| InChIKey | XLBAMSWFJFIDET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |