C11H8BrIN2O2S — CID 66286776
2-[(4-bromophenyl)sulfanylmethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one (PubChem CID 66286776) has the molecular formula C11H8BrIN2O2S and a molecular weight of 439.07 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfanylmethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-[(4-bromophenyl)sulfanylmethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66286776 |
| Molecular Formula | C11H8BrIN2O2S |
| Molecular Weight | 439.07 g/mol |
| Exact Mass | 437.85 |
| IUPAC Name | 2-[(4-bromophenyl)sulfanylmethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CSc2ccc(Br)cc2)nc(O)c1I |
| InChI | InChI=1S/C11H8BrIN2O2S/c12-6-1-3-7(4-2-6)18-5-8-14-10(16)9(13)11(17)15-8/h1-4H,5H2,(H2,14,15,16,17) |
| InChIKey | KJVRIOIICMBOQM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|