C15H16N4O2 — CID 66285924
methyl 4-(5-amino-1,3-dihydroisoindol-2-yl)-6-methylpyrimidine-2-carboxylate (PubChem CID 66285924) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 4-(5-amino-1,3-dihydroisoindol-2-yl)-6-methylpyrimidine-2-carboxylate.
| Compound Name | methyl 4-(5-amino-1,3-dihydroisoindol-2-yl)-6-methylpyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66285924 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | methyl 4-(5-amino-1,3-dihydroisoindol-2-yl)-6-methylpyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(N2Cc3ccc(N)cc3C2)n1 |
| InChI | InChI=1S/C15H16N4O2/c1-9-5-13(18-14(17-9)15(20)21-2)19-7-10-3-4-12(16)6-11(10)8-19/h3-6H,7-8,16H2,1-2H3 |
| InChIKey | KEZHMIJWKWILCP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|